CAS 25560-91-2
:Ethyl 4-(acetyloxy)butanoate
Description:
Ethyl 4-(acetyloxy)butanoate, with the CAS number 25560-91-2, is an ester compound characterized by its fruity aroma and flavor, making it useful in the food and fragrance industries. It is formed through the esterification of 4-hydroxybutanoic acid and ethanol, with an acetyl group contributing to its structure. This compound typically appears as a colorless to pale yellow liquid and is soluble in organic solvents, while being less soluble in water due to its hydrophobic characteristics. Ethyl 4-(acetyloxy)butanoate exhibits moderate volatility and can be sensitive to heat and light, which may affect its stability. Its chemical properties include the ability to undergo hydrolysis in the presence of water, reverting to its parent alcohol and acid. Additionally, it may participate in various chemical reactions, including transesterification and oxidation. Safety data indicates that, like many esters, it should be handled with care, as it may cause irritation upon contact with skin or eyes. Overall, this compound is valued for its sensory properties and potential applications in various industries.
Formula:C8H14O4
InChI:InChI=1/C8H14O4/c1-3-11-8(10)5-4-6-12-7(2)9/h3-6H2,1-2H3
InChI key:InChIKey=KMPQIYXXLIFPKA-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)CCOC(C)=O
Synonyms:- 4-Acetoxybutyric acid ethyl ester
- Butanoic acid, 4-(acetyloxy)-, ethyl ester
- Butyric acid, 4-hydroxy-, ethyl ester, acetate
- Ethyl 4-(Acetyloxy)Butanoate
- Ethyl 4-(acetyloxy)butyrate
- Ethyl 4-acetoxybutyrate
- Ethyl 4-acetoxybutanoate
- 4-(Acetyloxy)butanoic Acid Ethyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Ethyl 4-Acetoxybutanoate
CAS:Controlled ProductApplications Ethyl 4-Acetoxybutanoate (cas# 25560-91-2) is a compound useful in organic synthesis.
Formula:C8H14O4Color and Shape:NeatMolecular weight:174.19Ethyl 4-acetoxybutanoate
CAS:Controlled ProductEthyl 4-acetoxybutanoate is a fragrant chemical that is found in the skins of grapes. It is used in the production of anesthetics and has been shown to cause narcolepsy when administered in large doses. Ethyl 4-acetoxybutanoate binds to dopamine receptors, which may be related to its anaesthetic properties. This chemical also has an antagonistic effect on muscle activity and can cause muscle relaxation.Formula:C8H14O4Purity:Min. 95%Molecular weight:174.19 g/mol

